C14H9NO5 — CID 887709
2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 887709) has the molecular formula C14H9NO5 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 887709 |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C14H9NO5/c16-12-10-4-3-8(14(18)19)6-11(10)13(17)15(12)7-9-2-1-5-20-9/h1-6H,7H2,(H,18,19) |
| InChIKey | VALJDQQNBSEPEW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|