C20H12Br2N2O5 — CID 17296237
N-(3,5-dibromo-4-hydroxyphenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17296237) has the molecular formula C20H12Br2N2O5 and a molecular weight of 520.13 g/mol. Its IUPAC name is N-(3,5-dibromo-4-hydroxyphenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3,5-dibromo-4-hydroxyphenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17296237 |
| Molecular Formula | C20H12Br2N2O5 |
| Molecular Weight | 520.13 g/mol |
| Exact Mass | 517.91 |
| IUPAC Name | N-(3,5-dibromo-4-hydroxyphenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(O)c(Br)c1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C20H12Br2N2O5/c21-15-7-11(8-16(22)17(15)25)23-18(26)10-3-4-13-14(6-10)20(28)24(19(13)27)9-12-2-1-5-29-12/h1-8,25H,9H2,(H,23,26) |
| InChIKey | LQLZREIUSDVZAF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.13 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|