C24H16N4O5S — CID 17361516
2-(furan-2-ylmethyl)-1,3-dioxo-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]isoindole-5-carboxamide (PubChem CID 17361516) has the molecular formula C24H16N4O5S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxo-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361516 |
| Molecular Formula | C24H16N4O5S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]isoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2nccs2)cc1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C24H16N4O5S/c29-20(27-24-25-9-11-34-24)14-3-6-16(7-4-14)26-21(30)15-5-8-18-19(12-15)23(32)28(22(18)31)13-17-2-1-10-33-17/h1-12H,13H2,(H,26,30)(H,25,27,29) |
| InChIKey | LHTOLSHCQTZKAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|