C24H15F2N3O4S — CID 60578831
N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 60578831) has the molecular formula C24H15F2N3O4S and a molecular weight of 479.46 g/mol. Its IUPAC name is N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 60578831 |
| Molecular Formula | C24H15F2N3O4S |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(F)cc2F)s1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C24H15F2N3O4S/c25-15-5-3-13(20(26)10-15)8-17-11-27-24(34-17)28-21(30)14-4-6-18-19(9-14)23(32)29(22(18)31)12-16-2-1-7-33-16/h1-7,9-11H,8,12H2,(H,27,28,30) |
| InChIKey | WVJRCIBFOIYCDY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|