C20H12Cl2N2O4 — CID 46797627
N-(2,3-dichlorophenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 46797627) has the molecular formula C20H12Cl2N2O4 and a molecular weight of 415.23 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 46797627 |
| Molecular Formula | C20H12Cl2N2O4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C20H12Cl2N2O4/c21-15-4-1-5-16(17(15)22)23-18(25)11-6-7-13-14(9-11)20(27)24(19(13)26)10-12-3-2-8-28-12/h1-9H,10H2,(H,23,25) |
| InChIKey | AVPPDIZXOZRFGO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|