C26H18N4O5 — CID 55610660
2-(furan-2-ylmethyl)-1,3-dioxo-N-[3-(pyridine-4-carbonylamino)phenyl]isoindole-5-carboxamide (PubChem CID 55610660) has the molecular formula C26H18N4O5 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxo-N-[3-(pyridine-4-carbonylamino)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[3-(pyridine-4-carbonylamino)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55610660 |
| Molecular Formula | C26H18N4O5 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[3-(pyridine-4-carbonylamino)phenyl]isoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)c1)c1ccncc1 |
| InChI | InChI=1S/C26H18N4O5/c31-23(16-8-10-27-11-9-16)28-18-3-1-4-19(14-18)29-24(32)17-6-7-21-22(13-17)26(34)30(25(21)33)15-20-5-2-12-35-20/h1-14H,15H2,(H,28,31)(H,29,32) |
| InChIKey | UJWMQCMTIQJJKS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|