C24H17ClN4O4 — CID 55481067
N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55481067) has the molecular formula C24H17ClN4O4 and a molecular weight of 460.88 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55481067 |
| Molecular Formula | C24H17ClN4O4 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C24H17ClN4O4/c1-14-10-21(29(27-14)17-5-2-4-16(25)12-17)26-22(30)15-7-8-19-20(11-15)24(32)28(23(19)31)13-18-6-3-9-33-18/h2-12H,13H2,1H3,(H,26,30) |
| InChIKey | AKZOOMPCIOLFCH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|