C27H19N5O4 — CID 108730087
2-(furan-2-ylmethyl)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108730087) has the molecular formula C27H19N5O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108730087 |
| Molecular Formula | C27H19N5O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-(furan-2-ylmethyl)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(NC(=O)c3ccc4c(c3)C(=O)N(Cc3ccco3)C4=O)cc12 |
| InChI | InChI=1S/C27H19N5O4/c1-16-22-13-18(14-28-24(22)32(30-16)19-6-3-2-4-7-19)29-25(33)17-9-10-21-23(12-17)27(35)31(26(21)34)15-20-8-5-11-36-20/h2-14H,15H2,1H3,(H,29,33) |
| InChIKey | NCHMQDKVECSXBL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|