C22H20N4O2 — CID 108753755
4-ethoxy-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)benzamide (PubChem CID 108753755) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-ethoxy-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)benzamide.
| Compound Name | 4-ethoxy-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 108753755 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-ethoxy-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cnc3c(c2)c(C)nn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O2/c1-3-28-19-11-9-16(10-12-19)22(27)24-17-13-20-15(2)25-26(21(20)23-14-17)18-7-5-4-6-8-18/h4-14H,3H2,1-2H3,(H,24,27) |
| InChIKey | OMEOYXHILWWEQN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |