C27H24N4O2 — CID 108753826
N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-4-naphthalen-2-yloxybutanamide (PubChem CID 108753826) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-4-naphthalen-2-yloxybutanamide.
| Compound Name | N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-4-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 108753826 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)-4-naphthalen-2-yloxybutanamide |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(NC(=O)CCCOc3ccc4ccccc4c3)cc12 |
| InChI | InChI=1S/C27H24N4O2/c1-19-25-17-22(18-28-27(25)31(30-19)23-10-3-2-4-11-23)29-26(32)12-7-15-33-24-14-13-20-8-5-6-9-21(20)16-24/h2-6,8-11,13-14,16-18H,7,12,15H2,1H3,(H,29,32) |
| InChIKey | CZKUOIXKPUHWMA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|