C14H13N5O — CID 139016323
(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)urea (PubChem CID 139016323) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is (3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)urea.
| Compound Name | (3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)urea |
|---|---|
| PubChem CID | 139016323 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)urea |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(NC(N)=O)cc12 |
| InChI | InChI=1S/C14H13N5O/c1-9-12-7-10(17-14(15)20)8-16-13(12)19(18-9)11-5-3-2-4-6-11/h2-8H,1H3,(H3,15,17,20) |
| InChIKey | LEAPTNGJGQDMOV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |