C24H24N4O3 — CID 108753832
4-(4-methoxyphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide (PubChem CID 108753832) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide |
|---|---|
| PubChem CID | 108753832 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2cnc3c(c2)c(C)nn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-17-22-15-18(16-25-24(22)28(27-17)19-7-4-3-5-8-19)26-23(29)9-6-14-31-21-12-10-20(30-2)11-13-21/h3-5,7-8,10-13,15-16H,6,9,14H2,1-2H3,(H,26,29) |
| InChIKey | HKKCHGUWLCJIPN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|