C27H30N4O2 — CID 108753823
4-(4-tert-butylphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide (PubChem CID 108753823) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide |
|---|---|
| PubChem CID | 108753823 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-(3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-yl)butanamide |
| SMILES | Cc1nn(-c2ccccc2)c2ncc(NC(=O)CCCOc3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C27H30N4O2/c1-19-24-17-21(18-28-26(24)31(30-19)22-9-6-5-7-10-22)29-25(32)11-8-16-33-23-14-12-20(13-15-23)27(2,3)4/h5-7,9-10,12-15,17-18H,8,11,16H2,1-4H3,(H,29,32) |
| InChIKey | QKWICOPGHMLUFU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|