C22H20N4O3S — CID 26187387
N'-(4-ethoxybenzoyl)-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 26187387) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26187387 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2cc3c(C)nn(-c4ccccc4)c3s2)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-3-29-17-11-9-15(10-12-17)20(27)23-24-21(28)19-13-18-14(2)25-26(22(18)30-19)16-7-5-4-6-8-16/h4-13H,3H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | VDGGKYXTLMWLNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|