C16H16N4O3S — CID 66819117
2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethylcarbamic acid (PubChem CID 66819117) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethylcarbamic acid.
| Compound Name | 2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 66819117 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]ethylcarbamic acid |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)NCCNC(=O)O)cc12 |
| InChI | InChI=1S/C16H16N4O3S/c1-10-12-9-13(14(21)17-7-8-18-16(22)23)24-15(12)20(19-10)11-5-3-2-4-6-11/h2-6,9,18H,7-8H2,1H3,(H,17,21)(H,22,23) |
| InChIKey | WTSNHNGEEDUBEO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|