C33H34N6O2S2 — CID 3134145
3-methyl-N-[7-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]heptyl]-1-phenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 3134145) has the molecular formula C33H34N6O2S2 and a molecular weight of 610.81 g/mol. Its IUPAC name is 3-methyl-N-[7-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]heptyl]-1-phenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 3-methyl-N-[7-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]heptyl]-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3134145 |
| Molecular Formula | C33H34N6O2S2 |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 3-methyl-N-[7-[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]heptyl]-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)NCCCCCCCNC(=O)c3cc4c(C)nn(-c5ccccc5)c4s3)cc12 |
| InChI | InChI=1S/C33H34N6O2S2/c1-22-26-20-28(42-32(26)38(36-22)24-14-8-6-9-15-24)30(40)34-18-12-4-3-5-13-19-35-31(41)29-21-27-23(2)37-39(33(27)43-29)25-16-10-7-11-17-25/h6-11,14-17,20-21H,3-5,12-13,18-19H2,1-2H3,(H,34,40)(H,35,41) |
| InChIKey | FPINOJQPQJYBFI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|