C26H20N6O2S2 — CID 3226614
3-methyl-N'-(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 3226614) has the molecular formula C26H20N6O2S2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 3-methyl-N'-(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | 3-methyl-N'-(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3226614 |
| Molecular Formula | C26H20N6O2S2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 3-methyl-N'-(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)NNC(=O)c3cc4c(C)nn(-c5ccccc5)c4s3)cc12 |
| InChI | InChI=1S/C26H20N6O2S2/c1-15-19-13-21(35-25(19)31(29-15)17-9-5-3-6-10-17)23(33)27-28-24(34)22-14-20-16(2)30-32(26(20)36-22)18-11-7-4-8-12-18/h3-14H,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | GTXPUGPXNNCESM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|