C23H18N4O2S — CID 2330510
N'-[1-(1-benzofuran-2-yl)ethenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 2330510) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N'-[1-(1-benzofuran-2-yl)ethenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | N'-[1-(1-benzofuran-2-yl)ethenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2330510 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N'-[1-(1-benzofuran-2-yl)ethenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc2c(C)nn(-c3ccccc3)c2s1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H18N4O2S/c1-14-18-13-21(30-23(18)27(26-14)17-9-4-3-5-10-17)22(28)25-24-15(2)20-12-16-8-6-7-11-19(16)29-20/h3-13,24H,2H2,1H3,(H,25,28) |
| InChIKey | PALTVCQEGIFEQI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|