C20H18N4OS — CID 2369712
N'-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 2369712) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N'-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | N'-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2369712 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N'-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)NNC3=C4C=CC[C@@H]4C3)cc12 |
| InChI | InChI=1S/C20H18N4OS/c1-12-16-11-18(19(25)22-21-17-10-13-6-5-9-15(13)17)26-20(16)24(23-12)14-7-3-2-4-8-14/h2-5,7-9,11,13,21H,6,10H2,1H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | ZOXGJWBPYMYLHM-CYBMUJFWSA-N |
| XLogP | 3.86 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|