C20H18N4OS — CID 7458839
N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 7458839) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7458839 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[(Z)-[(1S,5R)-6-bicyclo[3.2.0]hept-3-enylidene]amino]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)N/N=C3/C[C@@H]4CC=C[C@H]34)cc12 |
| InChI | InChI=1S/C20H18N4OS/c1-12-16-11-18(19(25)22-21-17-10-13-6-5-9-15(13)17)26-20(16)24(23-12)14-7-3-2-4-8-14/h2-5,7-9,11,13,15H,6,10H2,1H3,(H,22,25)/b21-17-/t13-,15-/m0/s1 |
| InChIKey | NHRLWHXYDAXSMV-HMBSCEQFSA-N |
| XLogP | 4.08 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|