C19H21N3OS — CID 939101
azepan-1-yl-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone (PubChem CID 939101) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is azepan-1-yl-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone.
| Compound Name | azepan-1-yl-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 939101 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | azepan-1-yl-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)N3CCCCCC3)cc12 |
| InChI | InChI=1S/C19H21N3OS/c1-14-16-13-17(18(23)21-11-7-2-3-8-12-21)24-19(16)22(20-14)15-9-5-4-6-10-15/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3 |
| InChIKey | MDGOXQUIAFCDAN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |