C24H24N4O2S — CID 138994139
[4-(4-methoxyphenyl)piperazin-1-yl]-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone (PubChem CID 138994139) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 138994139 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(3-methyl-1-phenylthieno[3,2-d]pyrazol-5-yl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc4c(C)nn(-c5ccccc5)c4s3)CC2)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-17-21-16-22(31-24(21)28(25-17)19-6-4-3-5-7-19)23(29)27-14-12-26(13-15-27)18-8-10-20(30-2)11-9-18/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | BTLVUBXLNBPTTE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|