C27H23N5O4S2 — CID 4848832
N-(4-methylphenyl)-4-[[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 4848832) has the molecular formula C27H23N5O4S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methylphenyl)-4-[[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4848832 |
| Molecular Formula | C27H23N5O4S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | N-(4-methylphenyl)-4-[[(3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)NNC(=O)c3cc4c(C)nn(-c5ccccc5)c4s3)cc2)cc1 |
| InChI | InChI=1S/C27H23N5O4S2/c1-17-8-12-20(13-9-17)31-38(35,36)22-14-10-19(11-15-22)25(33)28-29-26(34)24-16-23-18(2)30-32(27(23)37-24)21-6-4-3-5-7-21/h3-16,31H,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | DCZKUXUQVZBBFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|