C19H16N4O3S2 — CID 9413201
3-methyl-1-phenyl-N-(3-sulfamoylphenyl)thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 9413201) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-methyl-1-phenyl-N-(3-sulfamoylphenyl)thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 3-methyl-1-phenyl-N-(3-sulfamoylphenyl)thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 9413201 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 3-methyl-1-phenyl-N-(3-sulfamoylphenyl)thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)Nc3cccc(S(N)(=O)=O)c3)cc12 |
| InChI | InChI=1S/C19H16N4O3S2/c1-12-16-11-17(27-19(16)23(22-12)14-7-3-2-4-8-14)18(24)21-13-6-5-9-15(10-13)28(20,25)26/h2-11H,1H3,(H,21,24)(H2,20,25,26) |
| InChIKey | DTCVUNYHNWSAMF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |