C22H21FN4O3S2 — CID 33426862
1-(4-fluorophenyl)-3-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 33426862) has the molecular formula C22H21FN4O3S2 and a molecular weight of 472.57 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-3-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 33426862 |
| Molecular Formula | C22H21FN4O3S2 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)c2cc3c(C)nn(-c4ccc(F)cc4)c3s2)cc1 |
| InChI | InChI=1S/C22H21FN4O3S2/c1-14-3-9-18(10-4-14)32(29,30)25-12-11-24-21(28)20-13-19-15(2)26-27(22(19)31-20)17-7-5-16(23)6-8-17/h3-10,13,25H,11-12H2,1-2H3,(H,24,28) |
| InChIKey | YZPJMBYOWIRJLI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|