C19H18ClN3OS — CID 55480086
N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4-(methylsulfanylmethyl)benzamide (PubChem CID 55480086) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4-(methylsulfanylmethyl)benzamide.
| Compound Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 55480086 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-4-(methylsulfanylmethyl)benzamide |
| SMILES | CSCc1ccc(C(=O)Nc2cc(C)nn2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-13-10-18(23(22-13)17-5-3-4-16(20)11-17)21-19(24)15-8-6-14(7-9-15)12-25-2/h3-11H,12H2,1-2H3,(H,21,24) |
| InChIKey | IMRIPIAWQVMKDW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |