C21H23ClN4O3S — CID 55493759
4-(butan-2-ylsulfamoyl)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]benzamide (PubChem CID 55493759) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-(butan-2-ylsulfamoyl)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]benzamide.
| Compound Name | 4-(butan-2-ylsulfamoyl)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 55493759 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-(butan-2-ylsulfamoyl)-N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]benzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)Nc2cc(C)nn2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-4-14(2)25-30(28,29)19-10-8-16(9-11-19)21(27)23-20-12-15(3)24-26(20)18-7-5-6-17(22)13-18/h5-14,25H,4H2,1-3H3,(H,23,27) |
| InChIKey | DYYBEHXNKWNGKQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |