C27H18N4O4 — CID 17360605
N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17360605) has the molecular formula C27H18N4O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17360605 |
| Molecular Formula | C27H18N4O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C27H18N4O4/c32-25(28-18-10-7-16(8-11-18)24-29-22-5-1-2-6-23(22)30-24)17-9-12-20-21(14-17)27(34)31(26(20)33)15-19-4-3-13-35-19/h1-14H,15H2,(H,28,32)(H,29,30) |
| InChIKey | YUHUFGNQWAWGMQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|