C20H14N2O6S — CID 43013635
methyl 3-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 43013635) has the molecular formula C20H14N2O6S and a molecular weight of 410.41 g/mol. Its IUPAC name is methyl 3-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43013635 |
| Molecular Formula | C20H14N2O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | methyl 3-[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C20H14N2O6S/c1-27-20(26)16-15(6-8-29-16)21-17(23)11-4-5-13-14(9-11)19(25)22(18(13)24)10-12-3-2-7-28-12/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | NZCUWOBGYKUFDK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|