C26H18FN3O5 — CID 55692711
N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55692711) has the molecular formula C26H18FN3O5 and a molecular weight of 471.44 g/mol. Its IUPAC name is N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55692711 |
| Molecular Formula | C26H18FN3O5 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1Oc1cccc(F)c1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C26H18FN3O5/c27-18-5-1-6-19(13-18)35-24-17(4-2-10-28-24)14-29-23(31)16-8-9-21-22(12-16)26(33)30(25(21)32)15-20-7-3-11-34-20/h1-13H,14-15H2,(H,29,31) |
| InChIKey | XKJQZVJOXGGVRV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|