C26H21FN2O4S — CID 55777426
3-(benzenesulfonylmethyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 55777426) has the molecular formula C26H21FN2O4S and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55777426 |
| Molecular Formula | C26H21FN2O4S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | O=C(NCc1cccnc1Oc1cccc(F)c1)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H21FN2O4S/c27-22-10-5-11-23(16-22)33-26-21(9-6-14-28-26)17-29-25(30)20-8-4-7-19(15-20)18-34(31,32)24-12-2-1-3-13-24/h1-16H,17-18H2,(H,29,30) |
| InChIKey | BPXDDAYXNZZUBT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |