C24H25N3O4S — CID 55774654
3-(benzenesulfonylmethyl)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide (PubChem CID 55774654) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 55774654 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
| SMILES | O=C(NCc1cccnc1N1CCOCC1)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3O4S/c28-24(26-17-21-8-5-11-25-23(21)27-12-14-31-15-13-27)20-7-4-6-19(16-20)18-32(29,30)22-9-2-1-3-10-22/h1-11,16H,12-15,17-18H2,(H,26,28) |
| InChIKey | OOMSDPATSNCAJM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |