C25H23N5O3 — CID 39248651
N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 39248651) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 39248651 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | O=C(NCc1cccnc1N1CCOCC1)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H23N5O3/c31-24(27-17-18-7-6-12-26-23(18)29-13-15-33-16-14-29)22-20-10-4-5-11-21(20)25(32)30(28-22)19-8-2-1-3-9-19/h1-12H,13-17H2,(H,27,31) |
| InChIKey | XNXQFQGQEKAFDS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |