C25H23N5O2 — CID 46598657
4-oxo-3-phenyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]phthalazine-1-carboxamide (PubChem CID 46598657) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-oxo-3-phenyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-phenyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 46598657 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-oxo-3-phenyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]phthalazine-1-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)nc1)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H23N5O2/c31-24(27-17-18-12-13-22(26-16-18)29-14-6-7-15-29)23-20-10-4-5-11-21(20)25(32)30(28-23)19-8-2-1-3-9-19/h1-5,8-13,16H,6-7,14-15,17H2,(H,27,31) |
| InChIKey | NIMJMPAEMOOYQL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |