C20H21BrN4O — CID 55665645
3-bromo-1-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]indole-2-carboxamide (PubChem CID 55665645) has the molecular formula C20H21BrN4O and a molecular weight of 413.32 g/mol. Its IUPAC name is 3-bromo-1-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]indole-2-carboxamide.
| Compound Name | 3-bromo-1-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 55665645 |
| Molecular Formula | C20H21BrN4O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 3-bromo-1-methyl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCc2ccc(N3CCCC3)nc2)c(Br)c2ccccc21 |
| InChI | InChI=1S/C20H21BrN4O/c1-24-16-7-3-2-6-15(16)18(21)19(24)20(26)23-13-14-8-9-17(22-12-14)25-10-4-5-11-25/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H,23,26) |
| InChIKey | XAXXMBROIUJDMX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |