C19H19BrN4O — CID 46435446
3-bromo-1-methyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)indole-2-carboxamide (PubChem CID 46435446) has the molecular formula C19H19BrN4O and a molecular weight of 399.29 g/mol. Its IUPAC name is 3-bromo-1-methyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)indole-2-carboxamide.
| Compound Name | 3-bromo-1-methyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 46435446 |
| Molecular Formula | C19H19BrN4O |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-bromo-1-methyl-N-(6-pyrrolidin-1-yl-3-pyridinyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(N3CCCC3)nc2)c(Br)c2ccccc21 |
| InChI | InChI=1S/C19H19BrN4O/c1-23-15-7-3-2-6-14(15)17(20)18(23)19(25)22-13-8-9-16(21-12-13)24-10-4-5-11-24/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,22,25) |
| InChIKey | AOGDLRVKWJUBSH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |