C16H18N4O — CID 43704451
4-amino-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide (PubChem CID 43704451) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-amino-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide.
| Compound Name | 4-amino-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 43704451 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-amino-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(N3CCCC3)nc2)cc1 |
| InChI | InChI=1S/C16H18N4O/c17-13-5-3-12(4-6-13)16(21)19-14-7-8-15(18-11-14)20-9-1-2-10-20/h3-8,11H,1-2,9-10,17H2,(H,19,21) |
| InChIKey | IQLOVKGHWSULJP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|