C19H23N5O — CID 56799221
6-(cyclopropylamino)-N-(6-piperidin-1-yl-3-pyridinyl)pyridine-3-carboxamide (PubChem CID 56799221) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N-(6-piperidin-1-yl-3-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropylamino)-N-(6-piperidin-1-yl-3-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56799221 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 6-(cyclopropylamino)-N-(6-piperidin-1-yl-3-pyridinyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)nc1)c1ccc(NC2CC2)nc1 |
| InChI | InChI=1S/C19H23N5O/c25-19(14-4-8-17(20-12-14)22-15-5-6-15)23-16-7-9-18(21-13-16)24-10-2-1-3-11-24/h4,7-9,12-13,15H,1-3,5-6,10-11H2,(H,20,22)(H,23,25) |
| InChIKey | LIYQADSOCBVQKY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |