C20H20BrN3O — CID 46435453
3-bromo-1-methyl-N-(2-pyrrolidin-1-ylphenyl)indole-2-carboxamide (PubChem CID 46435453) has the molecular formula C20H20BrN3O and a molecular weight of 398.30 g/mol. Its IUPAC name is 3-bromo-1-methyl-N-(2-pyrrolidin-1-ylphenyl)indole-2-carboxamide.
| Compound Name | 3-bromo-1-methyl-N-(2-pyrrolidin-1-ylphenyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 46435453 |
| Molecular Formula | C20H20BrN3O |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-bromo-1-methyl-N-(2-pyrrolidin-1-ylphenyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccccc2N2CCCC2)c(Br)c2ccccc21 |
| InChI | InChI=1S/C20H20BrN3O/c1-23-16-10-4-2-8-14(16)18(21)19(23)20(25)22-15-9-3-5-11-17(15)24-12-6-7-13-24/h2-5,8-11H,6-7,12-13H2,1H3,(H,22,25) |
| InChIKey | HHCHKJKWAJUJLG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |