C17H17BrN2O3 — CID 3019649
4-bromo-3,5-dihydroxy-N-(2-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 3019649) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is 4-bromo-3,5-dihydroxy-N-(2-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-bromo-3,5-dihydroxy-N-(2-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 3019649 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 4-bromo-3,5-dihydroxy-N-(2-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1)c1cc(O)c(Br)c(O)c1 |
| InChI | InChI=1S/C17H17BrN2O3/c18-16-14(21)9-11(10-15(16)22)17(23)19-12-5-1-2-6-13(12)20-7-3-4-8-20/h1-2,5-6,9-10,21-22H,3-4,7-8H2,(H,19,23) |
| InChIKey | JERQMMFDQOYDSE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |