C22H22N2OS — CID 126661345
5-phenyl-N-(2-piperidin-1-ylphenyl)thiophene-3-carboxamide (PubChem CID 126661345) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 5-phenyl-N-(2-piperidin-1-ylphenyl)thiophene-3-carboxamide.
| Compound Name | 5-phenyl-N-(2-piperidin-1-ylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126661345 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-phenyl-N-(2-piperidin-1-ylphenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1csc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2OS/c25-22(18-15-21(26-16-18)17-9-3-1-4-10-17)23-19-11-5-6-12-20(19)24-13-7-2-8-14-24/h1,3-6,9-12,15-16H,2,7-8,13-14H2,(H,23,25) |
| InChIKey | YUNLGOCSPKLSEF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |