C16H13BrN2O2 — CID 46435355
3-bromo-N-(2-hydroxyphenyl)-1-methylindole-2-carboxamide (PubChem CID 46435355) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-bromo-N-(2-hydroxyphenyl)-1-methylindole-2-carboxamide.
| Compound Name | 3-bromo-N-(2-hydroxyphenyl)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 46435355 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-bromo-N-(2-hydroxyphenyl)-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccccc2O)c(Br)c2ccccc21 |
| InChI | InChI=1S/C16H13BrN2O2/c1-19-12-8-4-2-6-10(12)14(17)15(19)16(21)18-11-7-3-5-9-13(11)20/h2-9,20H,1H3,(H,18,21) |
| InChIKey | LXFWJFACFDSLKF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|