C20H22F3N3O — CID 53149086
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(trifluoromethyl)benzamide (PubChem CID 53149086) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 53149086 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O/c21-20(22,23)17-8-4-3-7-16(17)19(27)25-14-15-9-10-18(24-13-15)26-11-5-1-2-6-12-26/h3-4,7-10,13H,1-2,5-6,11-12,14H2,(H,25,27) |
| InChIKey | GNUTWHRINUWKEI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |