C25H28N4O5S — CID 43057948
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide (PubChem CID 43057948) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 43057948 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)NCc3cccnc3N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H28N4O5S/c1-28(21-8-10-22(33-2)11-9-21)35(31,32)23-7-3-5-19(17-23)25(30)27-18-20-6-4-12-26-24(20)29-13-15-34-16-14-29/h3-12,17H,13-16,18H2,1-2H3,(H,27,30) |
| InChIKey | BRHAWNZQNRTFCG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |