C24H25N3O5S — CID 55688761
N-[(3-acetamidophenyl)methyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide (PubChem CID 55688761) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[(3-acetamidophenyl)methyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide.
| Compound Name | N-[(3-acetamidophenyl)methyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 55688761 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[(3-acetamidophenyl)methyl]-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)NCc3cccc(NC(C)=O)c3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-17(28)26-20-8-4-6-18(14-20)16-25-24(29)19-7-5-9-23(15-19)33(30,31)27(2)21-10-12-22(32-3)13-11-21/h4-15H,16H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | QBCDYXRCMFWJLP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |