C22H21N3O5S — CID 2572195
3-(benzamidocarbamoyl)-N-(4-methoxyphenyl)-N-methylbenzenesulfonamide (PubChem CID 2572195) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-(benzamidocarbamoyl)-N-(4-methoxyphenyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-(benzamidocarbamoyl)-N-(4-methoxyphenyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2572195 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(benzamidocarbamoyl)-N-(4-methoxyphenyl)-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)NNC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21N3O5S/c1-25(18-11-13-19(30-2)14-12-18)31(28,29)20-10-6-9-17(15-20)22(27)24-23-21(26)16-7-4-3-5-8-16/h3-15H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | JEAZMTGPNHITBI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|