C18H18N2O4S — CID 30600851
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-prop-2-ynylbenzamide (PubChem CID 30600851) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-prop-2-ynylbenzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 30600851 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1cccc(S(=O)(=O)N(C)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-4-12-19-18(21)14-6-5-7-17(13-14)25(22,23)20(2)15-8-10-16(24-3)11-9-15/h1,5-11,13H,12H2,2-3H3,(H,19,21) |
| InChIKey | LLFHQEYSRYXDHN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|