C28H26N2O4S — CID 2399081
N-(2-benzylphenyl)-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide (PubChem CID 2399081) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-(2-benzylphenyl)-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide.
| Compound Name | N-(2-benzylphenyl)-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 2399081 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-(2-benzylphenyl)-3-[(4-methoxyphenyl)-methylsulfamoyl]benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)Nc3ccccc3Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H26N2O4S/c1-30(24-15-17-25(34-2)18-16-24)35(32,33)26-13-8-12-23(20-26)28(31)29-27-14-7-6-11-22(27)19-21-9-4-3-5-10-21/h3-18,20H,19H2,1-2H3,(H,29,31) |
| InChIKey | GAKVZMWWAKIMHG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |