C21H19ClFN3O4S — CID 55706412
4-chloro-3-(dimethylsulfamoyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 55706412) has the molecular formula C21H19ClFN3O4S and a molecular weight of 463.92 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55706412 |
| Molecular Formula | C21H19ClFN3O4S |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCc2cccnc2Oc2cccc(F)c2)ccc1Cl |
| InChI | InChI=1S/C21H19ClFN3O4S/c1-26(2)31(28,29)19-11-14(8-9-18(19)22)20(27)25-13-15-5-4-10-24-21(15)30-17-7-3-6-16(23)12-17/h3-12H,13H2,1-2H3,(H,25,27) |
| InChIKey | YZYPEBJDLAOHNM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |