C26H22FN3O5 — CID 55692907
N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55692907) has the molecular formula C26H22FN3O5 and a molecular weight of 475.48 g/mol. Its IUPAC name is N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55692907 |
| Molecular Formula | C26H22FN3O5 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1Oc1cccc(F)c1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C26H22FN3O5/c27-18-5-1-6-19(13-18)35-24-17(4-2-10-28-24)14-29-23(31)16-8-9-21-22(12-16)26(33)30(25(21)32)15-20-7-3-11-34-20/h1-2,4-6,8-10,12-13,20H,3,7,11,14-15H2,(H,29,31) |
| InChIKey | WICZCZJNOFYQKD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|